| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-Amino-2,6-Xylenol Hydrochloride |
|---|---|
| Synonyms | 4-Amino-2,6-Dimethylphenol Hydrochloride; 4-Amino-2,6-Dimethyl-Phenol Hydrochloride; 4-Amino-2,6-Dimethyl-Phenol; Hydron; Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 |
| CAS Registry Number | 10486-48-3 |
| EINECS | 234-008-2 |
| SMILES | [H+].C1=C(C(=C(C=C1N)C)O)C.[Cl-] |
| InChI | 1S/C8H11NO.ClH/c1-5-3-7(9)4-6(2)8(5)10;/h3-4,10H,9H2,1-2H3;1H |
| InChIKey | XHBKRIQIHBKJPE-UHFFFAOYSA-N |
| Boiling point | 282.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.8°C (Cal.) |
| (1) | Heyne Belinda. Mechanistic studies of fluorescent sensors for the detection of reactive oxygen species, Organic & Biomolecular Chemistry, 2008 |
|---|---|
| Market Analysis Reports |