| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| OX CHEM | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Diethyl N-Acetyl-L-Aspartate |
|---|---|
| Synonyms | (S)-Diethyl 2-acetamidosuccinate; diethyl (2S)-2-(acetylamino)butane-1,4-dioate; MFCD09954467 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 |
| CAS Registry Number | 1069-39-2 |
| SMILES | O=C(N[C@H](C(=O)OCC)CC(=O)OCC)C |
| InChI | 1S/C10H17NO5/c1-4-15-9(13)6-8(11-7(3)12)10(14)16-5-2/h8H,4-6H2,1-3H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | XQGDGRNHLJLQOV-QMMMGPOBSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.384°C at 760 mmHg (Cal.) |
| Flash point | 183.245°C (Cal.) |
| Refractive index | 1.449 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Diethyl N-Acetyl-L-Aspartate |