| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Chemical reagent >> Silane reagent |
|---|---|
| Name | 1,2-Dimethyl-1,1,2,2-Tetraphenyl-Disilane |
| Synonyms | 1,2-Dimethyl-1,1,2,2-Tetraphenyldisilane; Disilane, 1,2-Dimethyl-1,1,2,2-Tetraphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C26H26Si2 |
| Molecular Weight | 394.66 |
| CAS Registry Number | 1172-76-5 |
| EINECS | 214-632-1 |
| SMILES | C1=C(C=CC=C1)[Si](C2=CC=CC=C2)([Si](C3=CC=CC=C3)(C4=CC=CC=C4)C)C |
| InChI | 1S/C26H26Si2/c1-27(23-15-7-3-8-16-23,24-17-9-4-10-18-24)28(2,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | JNZRJYXUMDPPRK-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.243°C at 760 mmHg (Cal.) |
| Flash point | 207.347°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Kano et al.. Dianionic species with a bond consisting of two pentacoordinated silicon atoms, Nature Chemistry, 2010 |
|---|---|
| Market Analysis Reports |