Online Database of Chemicals from Around the World

Bis(methylcyclopentadienyl)nickel
[CAS# 1293-95-4]

List of Suppliers
Ereztech LLC USA
www.ereztech.com
+1 (888) 658-1221
sales@ereztech.com
Chemical distributor since 2010
chemBlink Standard supplier since 2011
Intatrade Chemicals GmbH Germany
www.intatrade.de
+49 (3493) 605-465
+49 (3493) 605-470
sales@intatrade.de
Chemical distributor
chemBlink Standard supplier since 2011
Sigma-Aldrich, Inc. China
www.sigmaaldrich.com
+86 (21) 6141-5566
800-819-3336
orderCN@sial.com
Chemical manufacturer since 1992
chemBlink Standard supplier since 2013
Fujian Wolfa Biotechnology Co., Ltd. China
www.wolfabio.com
+86 18050950397
jomin@wolfabio.com
WhatsApp:+86 18359103607
Chemical manufacturer since 2023
chemBlink Standard supplier since 2024

Identification
ClassificationOrganic raw materials >> Organometallic compound >> Organic nickel
NameBis(methylcyclopentadienyl)nickel
Synonyms1,1'-Dimethylnickelocene
Molecular StructureCAS # 1293-95-4, Bis(methylcyclopentadienyl)nickel
Molecular FormulaC12H14Ni
Molecular Weight216.93
CAS Registry Number1293-95-4
EC Number626-143-4
SMILESC[C]1[CH][CH][CH][CH]1.C[C]1[CH][CH][CH][CH]1.[Ni]
Properties
Melting point36-38 °C*
Boiling point85-90 °C (1 mmHg)
*Reynolds, L. T.
Safety Data
Hazard Symbolssymbol symbol   GHS07;GHS08 Warning  Details
Risk StatementsH302-H312-H332-H351-H361  Details
Safety StatementsP280  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Acute toxicityAcute Tox.4H332
Acute toxicityAcute Tox.4H302
Acute toxicityAcute Tox.4H312
SDSAvailable
up Discovery and Applications
Bis(methylcyclopentadienyl)nickel, often abbreviated as Ni(Cp*)₂, is a notable organometallic compound characterized by its unique bonding and reactivity properties. This compound features a nickel center coordinated to two methylcyclopentadienyl (Cp*) ligands, which are derived from cyclopentadiene with methyl substitutions. The compound's discovery and application reflect its significance in organometallic chemistry and industrial catalysis.

The discovery of Bis(methylcyclopentadienyl)nickel can be traced back to research in the field of organometallic chemistry during the mid-20th century. The development of various metal-cyclopentadienyl complexes was driven by their intriguing electronic properties and potential applications in catalysis. Researchers identified that replacing hydrogen atoms in cyclopentadiene with methyl groups enhanced the stability and solubility of the resulting complexes, leading to the synthesis of compounds like Bis(methylcyclopentadienyl)nickel.

In terms of applications, Bis(methylcyclopentadienyl)nickel plays a significant role in catalysis. Its structure allows it to act as a catalyst in various chemical reactions, including polymerization processes. The compound is particularly valuable in the production of high-performance polymers, such as those used in the manufacture of synthetic rubbers and advanced materials. Its ability to facilitate polymerization with precision and control contributes to the development of materials with specific properties tailored to industrial needs.

Moreover, Bis(methylcyclopentadienyl)nickel has found applications in the field of organic synthesis. Its reactivity and coordination chemistry make it a useful reagent in various synthetic transformations. For instance, it is employed in the synthesis of complex organic molecules through catalytic processes, showcasing its versatility in creating a wide range of chemical products.

In addition to its role in polymerization and organic synthesis, research continues to explore the potential of Bis(methylcyclopentadienyl)nickel in other areas, such as materials science and environmental applications. The compound's unique properties and reactivity hold promise for developing new technologies and advancing scientific knowledge in these fields.

Overall, Bis(methylcyclopentadienyl)nickel represents a significant advancement in organometallic chemistry with diverse applications. Its discovery has paved the way for innovations in catalysis and materials science, highlighting its importance in both academic research and industrial processes.

References

none
Market Analysis Reports
Related Products
5,5-Bis(9-methy...  Bis[(<sup>2</su...  Bis[(6-Methylcy...  Bis(Methylcyclo...  Bis(4-Methylcyc...  Bis(3-Methylcyc...  Bis(4-methylcyc...  Bis(Methylcyclo...  Bis(Methylcyclo...  Bis(methylcyclo...  Bis(Methylcyclo...  Bis(methylcyclo...  Bis(methylcyclo...  9,9-bis(methyl-...  Bis(2-methyldec...  1,2-Bis(Methyld...  Bis[2-(7-Methyl...  1,4-Bis(Methyld...  1,2-Bis(methyld...  N,N'-Bis[4-(4-M...