| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Phenyl Diphenylphosphinite |
|---|---|
| Synonyms | Phenoxydiphenylphosphine; Phenyldiphenylphosphinite(Diphenylphosphinicacidphenylester) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15OP |
| Molecular Weight | 278.28 |
| CAS Registry Number | 13360-92-4 |
| SMILES | C1=CC=C(C=C1)OP(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C18H15OP/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | UPDNYUVJHQABBS-UHFFFAOYSA-N |
| Boiling point | 391.3±25.0°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 235.2±23.4°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| (1) | Chih-Hao Chang, Chi-Lung Ho, Yu-Shuo Chang, I-Chun Lien, Cheng-Huei Lin, Ya-Wen Yang, Jia-Ling Liao and Yun Chi. Blue-emitting Ir(iii) phosphors with 2-pyridyl triazolate chromophores and fabrication of sky blue- and white-emitting OLEDs, J. Mater. Chem. C, 2013, 1, 2639. |
|---|---|
| Market Analysis Reports |