| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Dibenzyl Sebacate |
| Synonyms | Decanedioic Acid Bis(Phenylmethyl) Ester; Sebacic Acid Bis(Benzyl) Ester; Decanedioic Acid, Bis(Phenylmethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 |
| CAS Registry Number | 140-24-9 |
| EINECS | 205-404-2 |
| SMILES | C1=C(C=CC=C1)COC(=O)CCCCCCCCC(=O)OCC2=CC=CC=C2 |
| InChI | 1S/C24H30O4/c25-23(27-19-21-13-7-5-8-14-21)17-11-3-1-2-4-12-18-24(26)28-20-22-15-9-6-10-16-22/h5-10,13-16H,1-4,11-12,17-20H2 |
| InChIKey | DVLXEVMGHXWBOZ-UHFFFAOYSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.309°C at 760 mmHg (Cal.) |
| Flash point | 216.973°C (Cal.) |
| 27°C (Expl.) | |
| SDS | Available |
|---|---|
| Market Analysis Reports |