|
CAS#: 14802-44-9 Product: (E)-3-[2-(4-Pyridyl)Vinyl]Pyridine No suppilers available for the product. |
| Name | (E)-3-[2-(4-Pyridyl)Vinyl]Pyridine |
|---|---|
| Synonyms | 3-[(E)-2-Pyridin-4-Ylethenyl]Pyridine; 3-[2-(4-Pyridyl)Vinyl]Pyridine; 3-[(E)-2-(4-Pyridyl)Vinyl]Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 14802-44-9 (2682-93-1) |
| EINECS | 238-867-4 |
| SMILES | C2=C(\C=C\C1=CN=CC=C1)C=CN=C2 |
| InChI | 1S/C12H10N2/c1-2-12(10-14-7-1)4-3-11-5-8-13-9-6-11/h1-10H/b4-3+ |
| InChIKey | LELJBILQTLAIMQ-ONEGZZNKSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.484°C at 760 mmHg (Cal.) |
| Flash point | 123.466°C (Cal.) |
| (1) | Dushyant B. Varshney, Giannis S. Papaefstathiou and Leonard R. MacGillivray. Site-directed regiocontrolled synthesis of a ‘head-to-head’ photodimer via a single-crystal-to-single-crystal transformation involving a linear template, Chem. Commun., 2002, 0, 1964. |
|---|---|
| Market Analysis Reports |