| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Name | 2-Styrylbenzothiazole |
|---|---|
| Synonyms | 2-[(E)-2-Phenylethenyl]-1,3-Benzothiazole; 2-(2-Phenylvinyl)-1,3-Benzothiazole; 2-[(E)-2-Phenylvinyl]-1,3-Benzothiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11NS |
| Molecular Weight | 237.32 |
| CAS Registry Number | 1483-30-3 |
| SMILES | C2=C1SC(=NC1=CC=C2)\C=C\C3=CC=CC=C3 |
| InChI | 1S/C15H11NS/c1-2-6-12(7-3-1)10-11-15-16-13-8-4-5-9-14(13)17-15/h1-11H/b11-10+ |
| InChIKey | LCIISWPXOZNVIG-ZHACJKMWSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.96°C at 760 mmHg (Cal.) |
| Flash point | 206.509°C (Cal.) |
| (1) | O. Fedorova, Yu. V. Fedorov, E. Gulakova, N. Schepel, M. Alfimov, U. Goli and J. Saltiel. Supramolecular photochemical synthesis of an unsymmetrical cyclobutane, Photochem. Photobiol. Sci., 2007, 6, 1097. |
|---|---|
| Market Analysis Reports |