|
CAS#: 149-61-1 Product: Hydroxy-Butanedioic acid ion(2)- No suppilers available for the product. |
| Name | Hydroxy-Butanedioic acid ion(2)- |
|---|---|
| Synonyms | 2-Hydroxysuccinate; Butanedioic Acid, Hydroxy-, Ion(2)-; Chebi:15595 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4O5 |
| Molecular Weight | 132.07 |
| CAS Registry Number | 149-61-1 |
| SMILES | C(C(O)C([O-])=O)C([O-])=O |
| InChI | 1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/p-2 |
| InChIKey | BJEPYKJPYRNKOW-UHFFFAOYSA-L |
| Boiling point | 306.443°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 153.356°C (Cal.) |
| (1) | Devin G. Barrett and Muhammad N. Yousaf. Thermosets synthesized by thermal polyesterification for tissue engineering applications, Soft Matter, 2010, 6, 5026. |
|---|---|
| Market Analysis Reports |