| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-Oxobutanedioic Acid |
|---|---|
| Synonyms | 2-Ketosuccinate; Butanedioic Acid, Oxo-, Ion(2-); Chebi:16452 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H2O5 |
| Molecular Weight | 130.06 |
| CAS Registry Number | 149-63-3 |
| SMILES | C(C(=O)C([O-])=O)C([O-])=O |
| InChI | 1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9)/p-2 |
| InChIKey | KHPXUQMNIQBQEV-UHFFFAOYSA-L |
| Boiling point | 341.931°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.794°C (Cal.) |
| (1) | Serafimov JA�rg M.. Active site mutagenesis of the putative Diels-Alderase macrophomate synthase, Chemical Communications, 2007 |
|---|---|
| Market Analysis Reports |