| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Methyl L-Histidinate |
|---|---|
| Synonyms | (2S)-2-Amino-3-(3H-Imidazol-4-Yl)Propanoic Acid Methyl Ester; (2S)-2-Amino-3-(3H-Imidazol-4-Yl)Propionic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 |
| CAS Registry Number | 1499-46-3 |
| EINECS | 216-109-3 |
| SMILES | [C@H](N)(CC1=CN=C[NH]1)C(OC)=O |
| InChI | 1S/C7H11N3O2/c1-12-7(11)6(8)2-5-3-9-4-10-5/h3-4,6H,2,8H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | BXRMEWOQUXOLDH-LURJTMIESA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.243°C at 760 mmHg (Cal.) |
| Flash point | 176.507°C (Cal.) |
| (1) | Marjan Jebeli Javan, Zahra Jamshidi, Zahra Aliakbar Tehrani and Alireza Fattahi. Interactions of coinage metal clusters with histidine and their effects on histidine acidity; theoretical investigation, Org. Biomol. Chem., 2012, 10, 9373. |
|---|---|
| Market Analysis Reports |