| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 6,11-Dihydroxy-5,12-Naphthacenedione |
|---|---|
| Synonyms | 6,11-Dihydroxytetracene-5,12-Quinone; Nsc401184; 6,11-Dihydroxy-5,12-Naphthacenedione |
| Molecular Structure | ![]() |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27 |
| CAS Registry Number | 1785-52-0 |
| SMILES | C1=CC=CC2=C1C(=C3C(=C2O)C(C4=C(C3=O)C=CC=C4)=O)O |
| InChI | 1S/C18H10O4/c19-15-9-5-1-2-6-10(9)16(20)14-13(15)17(21)11-7-3-4-8-12(11)18(14)22/h1-8,19-20H |
| InChIKey | QECAURYYBPUIFF-UHFFFAOYSA-N |
| Density | 1.527g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.891°C at 760 mmHg (Cal.) |
| Flash point | 302.237°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ying-Feng Han, Yue Fei and Guo-Xin Jin. Self-assembled half-sandwich Ir, Rh-based organometallic molecular boxes for reversible trapping of halocarbon molecules, Dalton Trans., 2010, 39, 3976. |
|---|---|
| Market Analysis Reports |