|
CAS#: 186641-79-2 Product: (3R)-3-Methyl-4-{[(2-Methyl-2-Propanyl)(Diphenyl)Silyl]Oxy}Butanal No suppilers available for the product. |
| Name | (3R)-3-Methyl-4-{[(2-Methyl-2-Propanyl)(Diphenyl)Silyl]Oxy}Butanal |
|---|---|
| Synonyms | (3R)-3-Methyl-4-(tert-buty)diphenylsilyloxy)butanal; (R)-4-(tert-Butyldiphenylsilyloxy)-3-methylbutanal; nchembio.74-comp26a |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.53 |
| CAS Registry Number | 186641-79-2 |
| SMILES | O=CC[C@H](CO[Si](c1ccccc1)(c2ccccc2)C(C)(C)C)C |
| InChI | 1S/C21H28O2Si/c1-18(15-16-22)17-23-24(21(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,16,18H,15,17H2,1-4H3/t18-/m1/s1 |
| InChIKey | BRCGTKPAENHKCL-GOSISDBHSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.436°C at 760 mmHg (Cal.) |
| Flash point | 165.849°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| (1) | Yajima et al.. Synthesis and absolute configuration of hormone alpha1, Nature Chemical Biology, 2008 |
|---|---|
| Market Analysis Reports |