| Synchem OHG | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (5662) 40873-0 | |||
![]() |
info@synchem.de | |||
| Chemical manufacturer | ||||
| Name | 5-Bromotricyclo[8.2.2.24,7]Hexadeca-1(12),4,6,10,13,15-Hexaene |
|---|---|
| Synonyms | 5-bromotr |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15Br |
| Molecular Weight | 287.19 |
| CAS Registry Number | 1908-61-8 |
| SMILES | C1CC2=CC(=C(CCC3=CC=C1C=C3)C=C2)Br |
| InChI | 1S/C16H15Br/c17-16-11-14-6-5-12-1-3-13(4-2-12)7-9-15(16)10-8-14/h1-4,8,10-11H,5-7,9H2 |
| InChIKey | RJOYWTPJYZNRJD-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.5±31.0°C at 760 mmHg (Cal.) |
| Flash point | 174.6±19.3°C (Cal.) |
| Refractive index | 1.608 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Alex J. Roche and Belgin Canturk. An exploration of Suzuki aryl cross coupling chemistry involving [2.2]paracyclophane derivatives, Org. Biomol. Chem., 2005, 3, 515. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Bromotricyclo[8.2.2.24,7]Hexadeca-1(12),4,6,10,13,15-Hexaene |