Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Apollo Scientific Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (161) 406-0505 | |||
|
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Name | Benzoyl Glucuronide |
|---|---|
| Synonyms | (2S,3S,4S,5R,6S)-6-(Benzoyloxy)-3,4,5-Trihydroxy-Tetrahydropyran-2-Carboxylic Acid; (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(Oxo-Phenylmethoxy)-2-Tetrahydropyrancarboxylic Acid; (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-Phenylcarbonyloxy-Oxane-2-Carboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C13H14O8 |
| Molecular Weight | 298.25 |
| CAS Registry Number | 19237-53-7 |
| SMILES | [C@@H]2(O[C@@H](OC(=O)C1=CC=CC=C1)[C@@H]([C@H]([C@@H]2O)O)O)C(=O)O |
| InChI | 1S/C13H14O8/c14-7-8(15)10(11(17)18)20-13(9(7)16)21-12(19)6-4-2-1-3-5-6/h1-5,7-10,13-16H,(H,17,18)/t7-,8-,9+,10-,13-/m0/s1 |
| InChIKey | NLOPFVNXNMEEDI-UNLLLRGISA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.732°C at 760 mmHg (Cal.) |
| Flash point | 216.883°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzoyl Glucuronide |