| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Tyger Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | Trityl Methacrylate |
|---|---|
| Synonyms | triphenylmethyl methacrylate; Trityl methacrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.40 |
| CAS Registry Number | 19302-93-3 |
| SMILES | CC(=C)C(=O)OC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C23H20O2/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,1H2,2H3 |
| InChIKey | PTVDYMGQGCNETM-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.8±14.0°C at 760 mmHg (Cal.) |
| Flash point | 250.2±11.2°C (Cal.) |
| Refractive index | 1.584 (Cal.) |
| (1) | Kenji Ishitake, Kotaro Satoh, Masami Kamigaito and Yoshio Okamoto. From-syndiotactic-to-isotactic stereogradient methacrylic polymers by RAFT copolymerization of methacrylic acid and its bulky esters, Polym. Chem., 2012, 3, 1750. |
|---|---|
| Market Analysis Reports |