| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Aceanthrylene |
|---|---|
| Synonyms | Brn 3603293; Chebi:33086; Ccris 1998 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.26 |
| CAS Registry Number | 202-03-9 |
| SMILES | C1=C4C3=C(C2=C1C=CC=C2)C=CC3=CC=C4 |
| InChI | 1S/C16H10/c1-2-7-14-12(4-1)10-13-6-3-5-11-8-9-15(14)16(11)13/h1-10H |
| InChIKey | JDPAVWAQGBGGHD-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.711°C at 760 mmHg (Cal.) |
| Flash point | 188.59°C (Cal.) |
| (1) | Shinnosuke Horiuchi, Yuki Nishioka, Takashi Murase and Makoto Fujita. Both [2+2] and [2+4] additions of inert aromatics via identical ternary host–guest complexes, Chem. Commun., 2010, 46, 3460. |
|---|---|
| Market Analysis Reports |