|
CAS#: 20505-32-2 Product: Autumnolide No suppilers available for the product. |
| Name | Autumnolide |
|---|---|
| Synonyms | Autumnolide; C09346 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 20505-32-2 |
| SMILES | [C@H]12O[C@H]1[C@H](O)[C@@]4([C@@H]2[C@@H](C[C@H]3OC(=O)C([C@H]3[C@@H]4O)=C)C)C |
| InChI | 1S/C15H20O5/c1-5-4-7-8(6(2)14(18)19-7)12(16)15(3)9(5)10-11(20-10)13(15)17/h5,7-13,16-17H,2,4H2,1,3H3/t5-,7-,8-,9-,10-,11-,12+,13+,15-/m1/s1 |
| InChIKey | NWSWVIKHALGAER-KVLFNOHQSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.211°C at 760 mmHg (Cal.) |
| Flash point | 192.506°C (Cal.) |
| (1) | Von Dreele Robert B., Pettit George R., Cragg Gordon M., Ode Richard H.. Antineoplastic agents. 36. Crystal and molecular structure of the pseudoguaianolide autumnolide, Journal of the American Chemical Society, 1975 |
|---|---|
| Market Analysis Reports |