| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Interchim Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 560-8262 | |||
![]() |
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| Name | 2-O-beta-D-Glucopyranosyl-alpha-D-Glucopyranose |
|---|---|
| Synonyms | (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-[(2S,3R,4S,5S,6R)-2,4,5-Trihydroxy-6-(Hydroxymethyl)Tetrahydropyran-3-Yl]Oxy-Tetrahydropyran-3,4,5-Triol; (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-[[(2S,3R,4S,5S,6R)-2,4,5-Trihydroxy-6-(Hydroxymethyl)-3-Tetrahydropyranyl]Oxy]Tetrahydropyran-3,4,5-Triol; (2R,3S,4S,5R,6S)-2-Methylol-6-[(2S,3R,4S,5S,6R)-2,4,5-Trihydroxy-6-Methylol-Tetrahydropyran-3-Yl]Oxy-Tetrahydropyran-3,4,5-Triol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.30 |
| CAS Registry Number | 20880-64-2 |
| EINECS | 244-095-9 |
| SMILES | [C@@H]2(O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)[C@@H](O)[C@H](O)[C@H](O[C@@H]2O)CO |
| InChI | 1S/C12H22O11/c13-1-3-6(16)8(18)10(11(20)21-3)23-12-9(19)7(17)5(15)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11+,12+/m1/s1 |
| InChIKey | HIWPGCMGAMJNRG-NCFXGAEVSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 700.9±60.0°C at 760 mmHg (Cal.) |
| Flash point | 377.7±32.9°C (Cal.) |
| (1) | Tohru Taniguchi and Kenji Monde. Vibrational circular dichroism (VCD) studies on disaccharides in the CH region: toward discrimination of the glycosidic linkage position, Org. Biomol. Chem., 2007, 5, 1104. |
|---|---|
| Market Analysis Reports |