| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Analytical chemistry >> Standard >> Volatile organic compounds (VOCs) |
|---|---|
| Name | Picene |
| Synonyms | .Beta.,.Beta.-Binaphthyleneethene; 1,2,7,8-Dibenzphenanthrene; 1,2:7,8-Dibenzophenanthrene |
| Molecular Structure | ![]() |
| Molecular Formula | C22H14 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 213-46-7 |
| EINECS | 205-918-7 |
| SMILES | C1=C2C(=CC=C1)C=CC3=C2C=CC4=C3C=CC5=C4C=CC=C5 |
| InChI | 1S/C22H14/c1-3-7-17-15(5-1)9-11-21-19(17)13-14-20-18-8-4-2-6-16(18)10-12-22(20)21/h1-14H |
| InChIKey | GBROPGWFBFCKAG-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 367°C (Expl.) |
| Boiling point | 518.998°C at 760 mmHg (Cal.) |
| Flash point | 264.5±15.1°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Yoshihiro Kubozono, Hiroki Mitamura, Xuesong Lee, Xuexia He, Yusuke Yamanari, Yosuke Takahashi, Yuta Suzuki, Yumiko Kaji, Ritsuko Eguchi, Koki Akaike, Takashi Kambe, Hideki Okamoto, Akihiko Fujiwara, Takashi Kato, Taichi Kosugi and Hideo Aoki. Metal-intercalated aromatic hydrocarbons: a new class of carbon-based superconductors, Phys. Chem. Chem. Phys., 2011, 13, 16476. |
|---|---|
| Market Analysis Reports |