| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| BioBlocks Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 558-5900 | |||
![]() |
sales@bioblocks.com | |||
| Chemical manufacturer | ||||
| Name | [(1R,2S)-2-Aminocyclohexyl]Methanol |
|---|---|
| Synonyms | ((1R,2R)-2-AMINO-CYCLOHEXYL)-METHANOL; ((1R,2S)-2-aminocyclohexyl)methanol; cis-2-aminocyclohexanemethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 |
| CAS Registry Number | 213764-26-2 |
| SMILES | C1CC[C@@H]([C@@H](C1)CO)N |
| InChI | 1S/C7H15NO/c8-7-4-2-1-3-6(7)5-9/h6-7,9H,1-5,8H2/t6-,7-/m0/s1 |
| InChIKey | GCWPGEWXYDEQAY-BQBZGAKWSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.8±13.0°C at 760 mmHg (Cal.) |
| Flash point | 86.1±19.8°C (Cal.) |
| Refractive index | 1.477 (Cal.) |
| (1) | Géza Stájer, Angela E. Szabó, Ferenc Csende, Gyula Argay and Pál Sohár. Application of t-2-benzoyl-t-5-phenylcyclohexane-r-1-carboxylic acid for the preparation of saturated isoindole-fused heterocycles, J. Chem. Soc., Perkin Trans. 2, 2002, 0, 657. |
|---|---|
| Market Analysis Reports |