|
CAS#: 2221-41-2 Product: 4,6-Dimethoxyfuro[2,3-b]Quinoline No suppilers available for the product. |
| Name | 4,6-Dimethoxyfuro[2,3-b]Quinoline |
|---|---|
| Synonyms | 6-Methoxydictamnine; 6-Methoxy Dictamine; Brn 0616297 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 |
| CAS Registry Number | 2221-41-2 |
| SMILES | C1=COC2=NC3=C(C(=C12)OC)C=C(OC)C=C3 |
| InChI | 1S/C13H11NO3/c1-15-8-3-4-11-10(7-8)12(16-2)9-5-6-17-13(9)14-11/h3-7H,1-2H3 |
| InChIKey | ALLQMEDAYDKMIO-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.015°C at 760 mmHg (Cal.) |
| Flash point | 184.232°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Michael Joseph P.. Quinoline, quinazoline and acridone alkaloids, Natural Product Reports, 2007 |
|---|---|
| Market Analysis Reports |