| Shanghai Worldyang Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Aromatic cinnamic acid, esters and derivatives |
|---|---|
| Name | 4-Fluoro-3-(trifluoromethyl)cinnamic acid |
| Synonyms | (E)-3-[4-fluoro-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.15 |
| CAS Registry Number | 239463-90-2 |
| EC Number | 671-891-7 |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)C(F)(F)F)F |
| Solubility | 124.2 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.510, Calc.* |
| Melting point | 76.37 °C |
| Boiling Point | 288.52 °C, 294.0±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 131.6±25.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |