| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | (1R,2S,3S,4R)-Rel-5-Cyclohexene-1,2,3,4-Tetrol |
|---|---|
| Synonyms | 5-Cyclohexene-1,2,3,4-Tetrol; 5-Cyclohexene-1,2,3,4-Tetrol, (1Alpha,2Beta,3Alpha,4Beta)-(+-)-; 5-Cyclohexene-1,2,3,4-Tetrol, Trans-1,2,Cis-1,3,Trans-1,4-(+-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 |
| CAS Registry Number | 25348-64-5 |
| SMILES | [C@@H]1(C=C[C@@H]([C@H]([C@@H]1O)O)O)O |
| InChI | 1S/C6H10O4/c7-3-1-2-4(8)6(10)5(3)9/h1-10H/t3-,4-,5+,6+/m0/s1 |
| InChIKey | LRUBQXAKGXQBHA-UNTFVMJOSA-N |
| Density | 1.666g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.926°C at 760 mmHg (Cal.) |
| Flash point | 141.347°C (Cal.) |
| (1) | Innes Jean E., Edwards Paul J., Ley Steven V.. Dispiroketals in synthesis. Part 23.1 A new route to (+)-D-conduritol B from myo-inositol, Journal of the Chemical Society, Perkin Transactions 1, 1997 |
|---|---|
| Market Analysis Reports |