| R&D Scientific Inc. | Canada | |||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | 5-Methoxy-dl-tryptophan |
| Synonyms | 2-amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 |
| CAS Registry Number | 28052-84-8 |
| EC Number | 248-800-0 |
| SMILES | COC1=CC2=C(C=C1)NC=C2CC(C(=O)O)N |
| Solubility | 2311 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.663, Calc.* |
| Melting point | 300.51 °C |
| Boiling Point | 455.89 °C, 478.3±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 243.1±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H317 Details |
| Safety Statements | P280 Details |
| SDS | Available |
| Market Analysis Reports |