Online Database of Chemicals from Around the World

3-Nitro-4-phenoxy-5-sulfamoylbenzoic acid
[CAS# 28328-53-2]

List of Suppliers
Biosynth AG. Switzerland
www.biosynth.com
+41 (71) 858-2020
+41 (71) 858-2030
welcome@biosynth.ch
Chemical manufacturer
chemBlink Standard supplier since 2014
Shanghai Worldyang Chemical Co., Ltd. China
www.worldyachem.com
+86 13651600618
+86 (21) 5679-5779
+86 (21) 5679-5266
sales7777@worldyachem.com
QQ Chat
WeChat: 13651600618
WhatsApp:+86 13651600618
Chemical manufacturer since 2012

Identification
ClassificationAnalytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards
Name3-Nitro-4-phenoxy-5-sulfamoylbenzoic acid
Molecular StructureCAS # 28328-53-2, 3-Nitro-4-phenoxy-5-sulfamoylbenzoic acid
Molecular FormulaC13H10N2O7S
Molecular Weight338.29
CAS Registry Number28328-53-2
EC Number248-970-6
SMILESC1=CC=C(C=C1)OC2=C(C=C(C=C2S(=O)(=O)N)C(=O)O)[N+](=O)[O-]
Properties
SolubilityPractically insoluble (0.024 g/L) (25 °C), Calc.*
Density1.585±0.06 g/cm3 (20 °C 760 Torr), Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2014 ACD/Labs)
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH315-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Specific target organ toxicity - single exposureSTOT SE3H335
Eye irritationEye Irrit.2H319
Skin irritationSkin Irrit.2H315
SDSAvailable
up Discovery and Applications
3-Nitro-4-phenoxy-5-sulfamoylbenzoic acid is a significant chemical compound with notable applications in various fields, including medicinal chemistry and environmental science. This compound is recognized for its unique structural features and its utility in research and practical applications.

The discovery of 3-nitro-4-phenoxy-5-sulfamoylbenzoic acid arose from efforts to develop new chemical entities with specific properties. The compound is characterized by its benzoic acid core, which is substituted with a nitro group, a phenoxy group, and a sulfamoyl group. These substituents impart distinctive chemical and biological properties to the molecule, making it a subject of interest in several scientific domains.

The synthesis of 3-nitro-4-phenoxy-5-sulfamoylbenzoic acid involves several chemical reactions that introduce each functional group to the benzoic acid backbone. Typically, the process starts with the nitration of benzoic acid to introduce the nitro group. Subsequent reactions involve the introduction of the phenoxy group and the sulfamoyl group through various chemical transformations, such as nucleophilic substitution and sulfonation. These synthetic steps are designed to ensure the correct positioning and functionalization of the substituents.

In medicinal chemistry, 3-nitro-4-phenoxy-5-sulfamoylbenzoic acid has been explored for its potential therapeutic applications. The compound's ability to interact with biological targets, such as enzymes or receptors, makes it a candidate for drug development. For instance, the sulfamoyl group is known for its role in drug design due to its potential to interact with biological systems, while the nitro and phenoxy groups contribute to the molecule's overall activity and selectivity. Research into these interactions helps to identify the compound's efficacy and safety profile for potential medical use.

Beyond medicinal chemistry, 3-nitro-4-phenoxy-5-sulfamoylbenzoic acid finds applications in environmental science. Its chemical properties make it useful in the study of pollutants and their effects on ecosystems. The compound's ability to form complexes with metals or interact with other environmental substances provides insights into its environmental behavior and potential impact. This information is crucial for developing methods to mitigate pollution and manage chemical contaminants in various settings.

In summary, 3-nitro-4-phenoxy-5-sulfamoylbenzoic acid is a chemically complex compound with diverse applications in medicinal chemistry and environmental science. Its unique structure and functional groups contribute to its utility in research and practical applications, making it a valuable subject of study.

References

2003. Piretanide. Pharmaceutical Substances.
https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-16-0135

2003. Bumetanide. Pharmaceutical Substances.
https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-02-0139

List of 7074 potential endocrine disrupting compounds (EDCs) by PARC T4.2.
DOI: 10.5281/zenodo.10944198
Market Analysis Reports
Related Products
3-(4-Nitropheno...  N-[3-[3-(4-Nitr...  N-[3-[3-(3-Nitr...  3-(4-Nitropheno...  2-(3-Nitropheno...  4-(4-Nitropheno...  (3S)-3-(2-Nitro...  (3R)-3-(2-Nitro...  3-(4-Nitropheno...  3-Nitro-4-(phen...  3-(4-Nitropheno...  2-(2-Nitropheno...  1-Nitro-3-Pheno...  4-Nitro-1-Pheno...  2-(4-Nitropheno...  (2R,3S,4S,5S,6R...  4-Nitrophenyl  (3-Nitrophenyl)...  p-Nitrophenyl 2...  p-Nitrophenyl 2...