|
CAS#: 28675-08-3 Product: Dichlorodiphenyl ether No suppilers available for the product. |
| Name | Dichlorodiphenyl ether |
|---|---|
| Synonyms | Ai3-01203; Benzene, 1,1'-Oxybis-, Dichloro Derivative; Dichlorophenyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.10 |
| CAS Registry Number | 28675-08-3 |
| SMILES | C2=CC=C(OC1=CC=CC=C1)C(=C2Cl)Cl |
| InChI | 1S/C12H8Cl2O/c13-10-7-4-8-11(12(10)14)15-9-5-2-1-3-6-9/h1-8H |
| InChIKey | VSKSUBSGORDMQX-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.649°C at 760 mmHg (Cal.) |
| Flash point | 88.694°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichlorodiphenyl ether |