| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 2-Tert-Butylnaphthalene |
|---|---|
| Synonyms | .Beta.-Tert-Butylnaphthalene; 2-(1,1-Dimethylethyl)Naphthalene; Nsc91462 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 2876-35-9 |
| SMILES | C1=C(C(C)(C)C)C=CC2=C1C=CC=C2 |
| InChI | 1S/C14H16/c1-14(2,3)13-9-8-11-6-4-5-7-12(11)10-13/h4-10H,1-3H3 |
| InChIKey | MCEORGGPAKTORV-UHFFFAOYSA-N |
| Density | 0.969g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.776°C at 760 mmHg (Cal.) |
| Flash point | 121.611°C (Cal.) |
| (1) | Yoshiyuki Mizuhata, Takahiro Sasamori, Noriyoshi Nagahora, Yasuaki Watanabe, Yukio Furukawa and Norihiro Tokitoh. Synthesis and properties of stable 2-metallanaphthalenes of heavier group 14 elements, Dalton Trans., 2008, 4409. |
|---|---|
| Market Analysis Reports |