| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Classification | Analytical chemistry >> Standard >> Standard material |
|---|---|
| Name | Octachlorostyrene |
| Synonyms | 1,2,3,4,5-Pentachloro-6-(1,2,2-Trichlorovinyl)Benzene; Brn 2057011; Benzene, Pentachloro(Trichloroethenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8Cl8 |
| Molecular Weight | 379.71 |
| CAS Registry Number | 29082-74-4 |
| SMILES | C1(=C(C(=C(Cl)C(=C1Cl)Cl)Cl)Cl)C(=C(Cl)Cl)Cl |
| InChI | 1S/C8Cl8/c9-2-1(4(11)8(15)16)3(10)6(13)7(14)5(2)12 |
| InChIKey | RUYUCCQRWINUHE-UHFFFAOYSA-N |
| Density | 1.8g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.087°C at 760 mmHg (Cal.) |
| Flash point | 207.558°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Shaogang Chu, Adrian Covaci, Stefan Voorspoels and Paul Schepens. The distribution of octachlorostyrene (OCS) in environmental samples from Europe, J. Environ. Monit., 2003, 5, 619. |
|---|---|
| Market Analysis Reports |