Online Database of Chemicals from Around the World
alpha,alpha,alpha,alpha',alpha'-Pentafluoro-o-xylene
[CAS# 312-95-8]
Identification| Name | alpha,alpha,alpha,alpha',alpha'-Pentafluoro-o-xylene |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C8H5F5 |
| Molecular Weight | 196.12 |
| CAS Registry Number | 312-95-8 |
| EC Number | 206-234-1 |
| SMILES | C1=CC=C(C(=C1)C(F)F)C(F)(F)F |
|
Properties
| Solubility | 68.08 mg/L (25 °C water) |
|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.399, Calc.* |
| Melting point | -52.86 °C |
| Boiling Point | 123.10 °C, 150.3±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 46.2±12.8 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
1,2,3,3,4-Penta... 2,4,4,5,5-Penta... 1,1,3,3,3-Penta... 1,1,3,3,3-Penta... 1,2,3,4,5-Penta... 1,1,2,3,3-Penta... 2,3,4,5,6-Penta... 2,3,4,5,6-Penta... Pentafluorotung... Pentafluoro(Vin... Pentafluranol Pentagalacturon... 1,2,3,4,6-O-Pen... 1,2,3,4,6-Penta... Pentagastrin Pentagestrone (1beta→4)-Penta... Pentaglycerol Pentaglycine Pentaheptaconta...
