| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,5-Dichloroaniline hydrochloride |
|---|---|
| Synonyms | (2,5-Dichlorophenyl)Amine Hydrochloride; Aniline, 2,5-Dichloro-, Hydrochloride; 2,5-Dichloroanilinium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6Cl3N |
| Molecular Weight | 198.48 |
| CAS Registry Number | 33663-41-1 |
| EINECS | 251-620-5 |
| SMILES | [H+].C1=C(N)C(=CC=C1Cl)Cl.[Cl-] |
| InChI | 1S/C6H5Cl2N.ClH/c7-4-1-2-5(8)6(9)3-4;/h1-3H,9H2;1H |
| InChIKey | ZALVJCYWUBQENP-UHFFFAOYSA-N |
| Boiling point | 251°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100.4°C (Cal.) |
| (1) | Pierangelo Metrangolo, Tullio Pilati, Giancarlo Terraneo, Serena Biella and Giuseppe Resnati. Anion coordination and anion-templated assembly under halogen bonding control, CrystEngComm, 2009, 11, 1187. |
|---|---|
| Market Analysis Reports |