| Advanced Synthesis | USA | |||
|---|---|---|---|---|
![]() |
+1 (619) 423-7821 | |||
![]() |
sales@advancedsynthesis.com | |||
| Chemical manufacturer | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 4-n-Butoxybenzoyl Chloride |
|---|---|
| Synonyms | Zinc02242599; 222046_Aldrich |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 |
| CAS Registry Number | 33863-86-4 |
| EINECS | 251-703-6 |
| SMILES | C1=C(C=CC(=C1)C(=O)Cl)OCCCC |
| InChI | 1S/C11H13ClO2/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h4-7H,2-3,8H2,1H3 |
| InChIKey | KMGCTFHTBKBITO-UHFFFAOYSA-N |
| Density | 1.121 (Expl.) |
|---|---|
| 1.1±0.1g/cm3 (Cal.) | |
| Boiling point | 309.2±15.0°C at 760 mmHg (Cal.) |
| 161-162°C (Expl.) | |
| Flash point | 110°C (Expl.) |
| 115.0±20.8°C (Cal.) | |
| Refractive index | 1.5495 (Expl.) |
| Safety Code | S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3265 |
| Safety Description | DANGER: CORROSIVE, Water reactive, burns skin and eyes. |
| DANGER: CORROSIVE, burns skin and eyes | |
| SDS | Available |
| Market Analysis Reports |