| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Exclusive Chemistry Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (903) 713-5556 | |||
![]() |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| MolMall | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (21) 802-1834 | |||
![]() |
info@molmall.net | |||
| Chemical manufacturer since 2012 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 5-(4-Nitrophenyl)-2-Phenyl-2,4-Dihydro-3H-Pyrazol-3-One |
|---|---|
| Synonyms | "2,4-dihydro-5-(4-nitrophenyl)-2-phenyl-3H-pyrazol-3-one"; [34320-83-7]; 2,4-Dihydro-5-(4-nitrophenyl)-2-phenyl-3H-pyrazol-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 |
| CAS Registry Number | 34320-83-7 |
| SMILES | C1C(=NN(C1=O)C2=CC=CC=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
| InChI | 1S/C15H11N3O3/c19-15-10-14(11-6-8-13(9-7-11)18(20)21)16-17(15)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | FDAVFKZPGQEGDX-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 188-189°C (Expl.) |
| Boiling point | 445.1±47.0°C at 760 mmHg (Cal.) |
| Flash point | 223.0±29.3°C (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 25 mM in ethanol |
| SDS | Available |
|---|---|
| Market Analysis Reports |