| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sequoia Research Products Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (7802) 291-086 | |||
![]() |
info@seqchem.com | |||
| Chemical distributor | ||||
| Name | (1R,2S,4S,5R)-6-Methoxycyclohexane-1,2,3,4,5-Pentol |
|---|---|
| Synonyms | Zinc04097492; 2-O-Methyl-Chiro-Inositol; (-)-Quebrachitol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 |
| CAS Registry Number | 3564-07-6 |
| SMILES | [C@@H]1(O)[C@H]([C@@H]([C@@H]([C@@H](O)[C@H]1O)O)OC)O |
| InChI | 1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5+,6+,7-/m0/s1 |
| InChIKey | DSCFFEYYQKSRSV-FIZWYUIZSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Melting point | 190-198°C (Expl.) |
| Boiling point | 317.172°C at 760 mmHg (Cal.) |
| Flash point | 145.621°C (Cal.) |
| (1) | Kazuo Kurosawa, Toshihiko Nagase and Noritaka Chida. Total synthesis of (–)-stevastelin B, Chem. Commun., 2002, 0, 1280. |
|---|---|
| Market Analysis Reports |