| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Amino-6-(Hydroxymethyl)-7,8-Dihydro-1H-Pteridin-4-One |
|---|---|
| Synonyms | 2-Amino-6-Methylol-7,8-Dihydro-1H-Pteridin-4-One; C01300; 6-Pteridinemethanol, 2-Amino-7,8-Dihydro-4-Hydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 |
| CAS Registry Number | 3672-03-5 |
| SMILES | C(C2=NC1=C(NC(=NC1=O)N)NC2)O |
| InChI | 1S/C7H9N5O2/c8-7-11-5-4(6(14)12-7)10-3(2-13)1-9-5/h13H,1-2H2,(H4,8,9,11,12,14) |
| InChIKey | CQQNNQTXUGLUEV-UHFFFAOYSA-N |
| Density | 1.983g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.119°C at 760 mmHg (Cal.) |
| Flash point | 187.923°C (Cal.) |
| (1) | Hyun Uk Kim, Tae Yong Kim and Sang Yup Lee. Genome-scale metabolic network analysis and drug targeting of multi-drug resistant pathogen Acinetobacter baumanniiAYE, Mol. Biosyst., 2010, 6, 339. |
|---|---|
| Market Analysis Reports |