|
CAS#: 37280-82-3 Product: Methyl-Oxirane polymer with oxirane, phosphate No suppilers available for the product. |
| Name | Methyl-Oxirane polymer with oxirane, phosphate |
|---|---|
| Synonyms | Oxirane, Methyl-, Polymer With Oxirane, Phosphate; Polyoxyethylene Polyoxypropylene Phosphate; Propylene Oxide, Ethylene Oxide, Phosphoryl Chloride Reaction Product |
| Molecular Formula | C5H13O6P |
| Molecular Weight | 200.13 |
| CAS Registry Number | 37280-82-3 |
| SMILES | O=[P](O)(O)O.CC1OC1.C2OC2 |
| InChI | 1S/C3H6O.C2H4O.H3O4P/c1-3-2-4-3;1-2-3-1;1-5(2,3)4/h3H,2H2,1H3;1-2H2;(H3,1,2,3,4) |
| InChIKey | LPLZMRDWLYSJBC-UHFFFAOYSA-N |
| Boiling point | 158°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 222.6°C (Cal.) |
| Market Analysis Reports |