| Yangzhou Model Electronics Materials Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.modeltemol.com | |||
![]() | +86 13761402923 | |||
![]() | 245662540@qq.com | |||
| Chemical manufacturer since 2018 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic acid halide |
|---|---|
| Name | 5H-Octafluoropentanoyl chloride |
| Synonyms | 2,2,3,3,4,4,5,5-octafluoropentanoyl chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C5HClF8O |
| Molecular Weight | 264.50 |
| CAS Registry Number | 376-71-6 |
| EC Number | 671-231-8 |
| SMILES | C(C(C(C(C(=O)Cl)(F)F)(F)F)(F)F)(F)F |
| Solubility | 242.6 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.307, Calc.* |
| Melting point | -58.45 °C |
| Boiling Point | 80.45 °C, 91.4±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 9.1±25.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H314 Details | ||||||||
| Safety Statements | P260-P264-P280-P301+P330+P331-P302+P361+P354-P304+P340-P305+P354+P338-P316-P321-P363-P405-P501 Details | ||||||||
| Hazard Classification | |||||||||
| |||||||||
| SDS | Available | ||||||||
| Market Analysis Reports |