| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Ethylen-Bis-(4,6-Dimethyl-Tetrahydro-1,3,5-Thiadiazin-2-Thione) |
|---|---|
| Synonyms | 3-[2-(4,6-Dimethyl-2-Thioxo-1,3,5-Thiadiazinan-3-Yl)Ethyl]-4,6-Dimethyl-1,3,5-Thiadiazinane-2-Thione; D 682; Du Pont 328 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22N4S4 |
| Molecular Weight | 350.57 |
| CAS Registry Number | 3773-49-7 |
| SMILES | C(N1C(NC(C)SC1=S)C)CN2C(NC(C)SC2=S)C |
| InChI | 1S/C12H22N4S4/c1-7-13-9(3)19-11(17)15(7)5-6-16-8(2)14-10(4)20-12(16)18/h7-10,13-14H,5-6H2,1-4H3 |
| InChIKey | JZFICWYCTCCINF-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.716°C at 760 mmHg (Cal.) |
| Flash point | 244.529°C (Cal.) |
| (1) | Massimiliano Delferro, Luciano Marchiò, Matteo Tegoni, Saverio Tardito, Renata Franchi-Gazzola and Maurizio Lanfranchi. Synthesis, structural characterisation and solution chemistry of ruthenium(III) triazole-thiadiazine complexes, Dalton Trans., 2009, 3766. |
|---|---|
| Market Analysis Reports |