| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Creative Peptides | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink massive supplier since 2016 | ||||
| Name | H-Ile-Val-OH |
|---|---|
| Synonyms | (2S)-2-[[(2S,3S)-2-Amino-3-Methyl-Pentanoyl]Amino]-3-Methyl-Butanoic Acid; (2S)-2-[[(2S,3S)-2-Amino-3-Methyl-1-Oxopentyl]Amino]-3-Methylbutanoic Acid; (2S)-2-[[(2S,3S)-2-Amino-3-Methyl-Pentanoyl]Amino]-3-Methyl-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 |
| CAS Registry Number | 41017-96-3 |
| SMILES | [C@H](C(=O)O)(NC([C@@H](N)[C@H](CC)C)=O)C(C)C |
| InChI | 1S/C11H22N2O3/c1-5-7(4)8(12)10(14)13-9(6(2)3)11(15)16/h6-9H,5,12H2,1-4H3,(H,13,14)(H,15,16)/t7-,8-,9-/m0/s1 |
| InChIKey | BCXBIONYYJCSDF-CIUDSAMLSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.914°C at 760 mmHg (Cal.) |
| Flash point | 208.966°C (Cal.) |
| (1) | Angiolina Comotti, Silvia Bracco, Gaetano Distefano and Piero Sozzani. Methane, carbon dioxide and hydrogen storage in nanoporous dipeptide-based materials, Chem. Commun., 2009, 284. |
|---|---|
| Market Analysis Reports |