| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Lithium Dicyclohexylamide |
|---|---|
| Synonyms | Lithium Dicyclohexylamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22LiN |
| Molecular Weight | 187.25 |
| CAS Registry Number | 4111-55-1 |
| EINECS | 223-894-6 |
| SMILES | C2C([N-]C1CCCCC1)CCCC2.[Li+] |
| InChI | 1S/C12H22N.Li/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h11-12H,1-10H2;/q-1;+1 |
| InChIKey | HTZGVHYSMVGNOV-UHFFFAOYSA-N |
| Boiling point | 256.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 96.1°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Dipti Patel, William Lewis, Alexander J. Blake and Stephen T. Liddle. Uranium(iv) amide and halide derivatives of two tripodal tris(N-arylamido-dimethylsilyl)methanes, Dalton Trans., 2010, 39, 6638. |
|---|---|
| Market Analysis Reports |