| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Diazo-2,5-Heptanedione |
|---|---|
| Synonyms | 2,5-Heptanedione, 6-diazo-; 6-diazoheptane-2,5-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11N2O2 |
| Molecular Weight | 154.17 |
| CAS Registry Number | 437656-93-4 |
| SMILES | CC(=O)CCC(=O)C(=[N+]=[N-])C |
| InChI | 1S/C7H10N2O2/c1-5(10)3-4-7(11)6(2)9-8/h3-4H2,1-2H3 |
| InChIKey | YDDSQBKMJUMSOP-UHFFFAOYSA-N |
| Refractive index | (Cal.) |
|---|---|
| (1) | David M. Hodgson and Frédéric Le Strat. Use of allene in 1,3-dipolar addition to a carbonyl ylide: syntheses of 3-hydroxy-cis-nemorensic acid and nemorensic acid, Chem. Commun., 2004, 0, 822. |
|---|---|
| Market Analysis Reports |