| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,4-Dihydroxy-3,3-Dimethylbutanoic Acid |
|---|---|
| Synonyms | (2R)-2,4-Dihydroxy-3,3-Dimethyl-Butanoic Acid; (2R)-2,4-Dihydroxy-3,3-Dimethyl-Butyric Acid; (R)-Pantoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 |
| CAS Registry Number | 470-29-1 (1112-33-0) |
| SMILES | [C@@H](O)(C(CO)(C)C)C(=O)O |
| InChI | 1S/C6H12O4/c1-6(2,3-7)4(8)5(9)10/h4,7-8H,3H2,1-2H3,(H,9,10)/t4-/m0/s1 |
| InChIKey | OTOIIPJYVQJATP-BYPYZUCNSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.729°C at 760 mmHg (Cal.) |
| Flash point | 190.983°C (Cal.) |
| (1) | Jordan L. Meier and Michael D. Burkart. The chemical biology of modular biosynthetic enzymes, Chem. Soc. Rev., 2009, 38, 2012. |
|---|---|
| Market Analysis Reports |