| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Name | Tetrahydropapaveroline |
|---|---|
| Synonyms | 1-(3,4-Dihydroxybenzyl)-1,2,3,4-Tetrahydroisoquinoline-6,7-Diol; Tetrahydroxypapaveroline; Papaveroline, 1,2,3,4-Tetrahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 |
| CAS Registry Number | 4747-99-3 |
| SMILES | C1=C(O)C(=CC3=C1C(CC2=CC(=C(O)C=C2)O)NCC3)O |
| InChI | 1S/C16H17NO4/c18-13-2-1-9(6-14(13)19)5-12-11-8-16(21)15(20)7-10(11)3-4-17-12/h1-2,6-8,12,17-21H,3-5H2 |
| InChIKey | ABXZOXDTHTTZJW-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.2±50.0°C at 760 mmHg (Cal.) |
| Flash point | 235.1±20.7°C (Cal.) |
| (1) | Gregg B. Fields. Synthesis and biological applications of collagen-model triple-helical peptides, Org. Biomol. Chem., 2010, 8, 1237. |
|---|---|
| Market Analysis Reports |