| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alsachim SAS | France | |||
|---|---|---|---|---|
![]() |
+33 (368) 240-080 | |||
![]() |
contact@alsachim.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | Colchiceine |
|---|---|
| Synonyms | N-[(7S)-10-Hydroxy-9-Keto-1,2,3-Trimethoxy-6,7-Dihydro-5H-Benzo[D]Heptalen-7-Yl]Acetamide; N-[(7S)-10-Hydroxy-1,2,3-Trimethoxy-9-Oxo-6,7-Dihydro-5H-Benzo[D]Heptalen-7-Yl]Ethanamide; Kbiogr_001044 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 |
| CAS Registry Number | 477-27-0 |
| EINECS | 207-512-5 |
| SMILES | [C@H]3(C1=CC(C(=CC=C1C2=C(C=C(C(=C2OC)OC)OC)CC3)O)=O)NC(=O)C |
| InChI | 1S/C21H23NO6/c1-11(23)22-15-7-5-12-9-18(26-2)20(27-3)21(28-4)19(12)13-6-8-16(24)17(25)10-14(13)15/h6,8-10,15H,5,7H2,1-4H3,(H,22,23)(H,24,25)/t15-/m0/s1 |
| InChIKey | PRGILOMAMBLWNG-HNNXBMFYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 731.5±60.0°C at 760 mmHg (Cal.) |
| Flash point | 396.2±32.9°C (Cal.) |
| (1) | Marino Cavazza and Francesco Pietra. Tautomeric selectivity towards colchicinoids in the tosylation of colchiceine on a heterogeneous, easily removable catalyst, Org. Biomol. Chem., 2003, 1, 3002. |
|---|---|
| Market Analysis Reports |