| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chemstock, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (715) 726-1437 | |||
![]() |
Evelyn@chemstock.com | |||
| Chemical distributor | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tyger Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 1,6-Bismaleimidohexane |
|---|---|
| Synonyms | 1-[6-(2,5-Dioxo-1-Pyrrolyl)Hexyl]Pyrrole-2,5-Dione; 1-(6-Maleimidohexyl)-3-Pyrroline-2,5-Quinone; Maleimide, N,N'-Hexamethylenedi- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 |
| CAS Registry Number | 4856-87-5 |
| EINECS | 225-449-1 |
| SMILES | C(N1C(C=CC1=O)=O)CCCCCN2C(C=CC2=O)=O |
| InChI | 1S/C14H16N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10-16-13(19)7-8-14(16)20/h5-8H,1-4,9-10H2 |
| InChIKey | PYVHLZLQVWXBDZ-UHFFFAOYSA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Melting point | 144°C (Expl.) |
| Boiling point | 465.712°C at 760 mmHg (Cal.) |
| Flash point | 218.12°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Rolf Tona and Robert Häner. Crosslinking of diene-modified DNA with bis-maleimides, Mol. Biosyst., 2005, 1, 93. |
|---|---|
| Market Analysis Reports |