| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol |
|---|---|
| Synonyms | (1s,2R,3R,4s,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol; 1,2,3/4,5,6-cyclohexanehexol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 |
| CAS Registry Number | 488-54-0 |
| SMILES | [C@@H]1([C@@H]([C@@H]([C@@H]([C@H]([C@H]1O)O)O)O)O)O |
| InChI | 1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5-,6- |
| InChIKey | CDAISMWEOUEBRE-DCLYFUHFSA-N |
| Density | 2.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.3±40.0°C at 760 mmHg (Cal.) |
| Flash point | 143.4±21.9°C (Cal.) |
| (1) | Arnaud Bonnet, James Chisholm, W. D. Sam Motherwell and William Jones. Hydrogen bonding preference of equatorial versus axial hydroxyl groups in pyran and cyclohexane rings in organic crystals, CrystEngComm, 2005, 7, 71. |
|---|---|
| Market Analysis Reports |