| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Georganics Ltd. | Slovakia | |||
|---|---|---|---|---|
![]() |
+421 (33) 640-3132 | |||
![]() |
georganics@nextra.sk | |||
| Chemical manufacturer since 1998 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-Methoxy-4-Nitronaphthalene |
|---|---|
| Synonyms | 1-Methoxy-4-Nitro-Naphthalene; M18000_Aldrich; Nciopen2_003101 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 |
| CAS Registry Number | 4900-63-4 |
| EINECS | 225-528-0 |
| SMILES | C1=CC=CC2=C(C=CC(=C12)[N+](=O)[O-])OC |
| InChI | 1S/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| InChIKey | YFJKGPRYPHFGQD-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Melting point | 83-85°C (Expl.) |
| Boiling point | 367.242°C at 760 mmHg (Cal.) |
| Flash point | 178.342°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Helmut Görner and Dietrich Döpp. Photoreduction induced by electron transfer from di- and trialkylamines to the triplet state of nitronaphthalenes in polar media, J. Chem. Soc., Perkin Trans. 2, 2002, 0, 120. |
|---|---|
| Market Analysis Reports |