| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3-Pyrrol-2-ylpyridine |
|---|---|
| Synonyms | 3-Pyrrol-2-Ylpyridine; Brn 0113590; Nornicotyrine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 |
| CAS Registry Number | 494-98-4 |
| SMILES | C1=C([NH]C=C1)C2=CN=CC=C2 |
| InChI | 1S/C9H8N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1-7,11H |
| InChIKey | CBTWKRLUNDZXIF-UHFFFAOYSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.719°C at 760 mmHg (Cal.) |
| Flash point | 152.497°C (Cal.) |
| (1) | Darren J. Mercer and Stephen J. Loeb. Metal-based anion receptors: an application of second-sphere coordination, Chem. Soc. Rev., 2010, 39, 3612. |
|---|---|
| Market Analysis Reports |