| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Name | Methyl 4,6-Dichloro-4,6-Dideoxy-alpha-Galactopyranoside |
|---|---|
| Synonyms | (2S,3R,4R,5R,6R)-5-Chloro-6-(Chloromethyl)-2-Methoxy-Tetrahydropyran-3,4-Diol; (2S,3R,4R,5R,6R)-5-Chloro-6-(Chloromethyl)-2-Methoxytetrahydropyran-3,4-Diol; (2S,3R,4R,5R,6R)-5-Chloro-6-(Chloromethyl)-2-Methoxy-Oxane-3,4-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12Cl2O4 |
| Molecular Weight | 231.08 |
| CAS Registry Number | 4990-82-3 |
| SMILES | [C@@H]1(OC)[C@H](O)[C@@H](O)[C@H]([C@H](O1)CCl)Cl |
| InChI | 1S/C7H12Cl2O4/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-7,10-11H,2H2,1H3/t3-,4+,5+,6-,7+/m1/s1 |
| InChIKey | VPDVIMQPZYMQKN-PZRMXXKTSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.48°C at 760 mmHg (Cal.) |
| Flash point | 189.351°C (Cal.) |
| (1) | Ruben P. van Summeren, Ben L. Feringa and Adriaan J. Minnaard. New approaches towards the synthesis of the side-chain of mycolactones A and B, Org. Biomol. Chem., 2005, 3, 2524. |
|---|---|
| Market Analysis Reports |