| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| RIA International LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Name | Pridinol |
|---|---|
| Synonyms | 1,1-Di(Phenyl)-3-(1-Piperidyl)Propan-1-Ol; 1,1-Di(Phenyl)-3-Piperidino-Propan-1-Ol; 1,1-Di(Phenyl)-3-Piperidin-1-Yl-Propan-1-Ol |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.42 |
| CAS Registry Number | 511-45-5 |
| EINECS | 208-128-0 |
| SMILES | C3=C(C(C1=CC=CC=C1)(CCN2CCCCC2)O)C=CC=C3 |
| InChI | 1S/C20H25NO/c22-20(18-10-4-1-5-11-18,19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21/h1-2,4-7,10-13,22H,3,8-9,14-17H2 |
| InChIKey | RQXCLMGKHJWMOA-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 229.9±27.4°C (Cal.) |
| (1) | Tomasz Han, Józef Utko, Lucjan B. Jerzykiewicz and Piotr Sobota. Design of a magnesium-pridinolum complex for polylactide–drug conjugates formation, Dalton Trans., 2011, 40, 12660. |
|---|---|
| Market Analysis Reports |